|
|
Year of first isolation: |
2017 |
Formula: | C29H46O9 |
Molecular weight: | 538 |
Occurence in plants: |
Serratula chinensis [Asteraceae] » ![Wikipedia: <br />
<b>Warning</b>: preg_replace() [<a href='function.preg-replace'>function.preg-replace</a>]: No ending delimiter '&' found in <b>/usr/local/www/apache22/data/ecdybase.org/www/sheet.inc</b> on line <b>60</b><br />](/images/wikipedia.png)
|
Occurence in animals: |
|
|
| |
Canonical SMILES | | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2([C@@H](C[C@H]([C@H]1O)O)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2[C@](C)([C@H](O)C[C@H](C(C)(C)O)OC(=O)C)O)O)C)C » 
| IUPAC Name | | CAS-RN | | PubChem CID | | InChiKey [ ChemIDPlus: search ] | ZUZLCBCDCHXDBV-RFNGHESCSA-N | InChI | InChI=1S/C29H46O9/c1-15(30)38-24(25(2,3)35)13-23(34)28(6,36)22-8-10-29(37)17-11-19(31)18-12-20(32)21(33)14-26(18,4)16(17)7-9-27(22,29)5/h11,16,18,20-24,32-37H,7-10,12-14H2,1-6H3/t16-,18-,20+,21-,22-,23+,24+,26+,27+,28+,29+/m0/s1 |
| |
HRESI-MS | 561.3045 [M+Na]+, calculated 561.3034 for C29H46O9Na |
|
|
CD3OD | 01 | 37.4 | 02 | 68.7 | 03 | 68.5 | 04 | 32.8 | 05 | 51.8 | 06 | 206.2 | 07 | 121.8 | 08 | 167.9 | 09 | 35.1 | 10 | 39.3 | 11 | 21.5 | 12 | 32.5 | 13 | 48.5 | 14 | 85.2 | 15 | 31.8 | 16 | 21.3 | 17 | 50.4 | 18 | 18.1 | 19 | 24.4 | 20 | 77.6 | 21 | 21.0 | 22 | 73.8 | 23 | 33.1 | 24 | 78.7 | 25 | 72.7 | 26 | 26.0 | 27 | 26.0 | Ac 1´ | 173.0 | Ac 2´ | 21.0 |
|
CD3OD | 01-Ha | 1.44 | 01-He | 1.80 | 02-Ha | 3.84 | 03-He | 3.96 (br, s) | 04-Ha | 1.72 | 04-He | 1.72 | 05-H | 2.40 (dd, 13.0, 4.5) | 07-H | 5.82 (d, 2.5) | 09-H | 3.17 | 11-Ha | 1.70 | 11-He | 1.81 | 12-Ha | 2.14 | 12-He | 1.77 | 15-Ha | 1.61 | 15-Hb | 1.96 | 16-Ha | 1.98 | 16-Hb | 1.72 | 17-H | 2.35 (t, 9.5) | 18-Me | 0.90 (s) | 19-Me | 0.98 (s) | 21-Me | 1.20 (s) | 22-H | 3.31 | 23-Ha | 1.76 | 23-Hb | 1.57 | 24-H | 5.09 (dd, 10.5, 1.5) | 26-Me | 1.21 (s) | 27-Me | 1.19 (s) | CH3-CO | 2.11 (s) |
|
| |
M.P. | °C ; | [α]D25 | + 45.4 ° (c 0.01; MeOH) | IR (KBr) ν max (cm-1) | 3420, 2964, 2929, 1713, 1648, 1383, 1054 | UV (MeOH) λ max (log ε) | 242 () ; |
| |
| |
| |
|
Permanent link to this datasheet: 24-O-ACETYL-EPI-ABUTASTERONE
|
|