|
|
Year of first isolation: |
2008 |
Formula: | C27H42O7 |
Molecular weight: | 478 |
Occurence in plants: |
Serratula wolffii [Asteraceae] » ![Wikipedia: <br />
<b>Warning</b>: preg_replace() [<a href='function.preg-replace'>function.preg-replace</a>]: No ending delimiter '&' found in <b>/usr/local/www/apache22/data/ecdybase.org/www/sheet.inc</b> on line <b>63</b><br />](/images/wikipedia.png)
|
Occurence in animals: |
|
|
| |
Canonical SMILES | CC1(CCC(O1)C(C)(C2CCC3(C2(CC(C4C3=CC(=O)C5C4(CC(C(C5)O)O)C)O)C)O)O)C | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2([C@@H](C[C@H]([C@H]1O)O)C(=O)C=C1[C@@H]2[C@@H](C[C@]2([C@]1(CC[C@@H]2[C@](C)([C@H]1CCC(O1)(C)C)O)O)C)O)C » 
| IUPAC Name | (2S,3R,5R,9R,10R,11R,13R,14S,17S)-17-[(1R)-1-[(2R)-5,5-dimethyloxolan-2-yl]-1-hydroxyethyl]-2,3,11,14-tetrahydroxy-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one | CAS-RN | | PubChem CID | 102478940 | InChiKey [ ChemIDPlus: search ] | CQINRNNJHLCPFQ-XHZKDPLLSA-N | InChI | InChI=1S/C27H42O7/c1-23(2)8-7-21(34-23)26(5,32)20-6-9-27(33)15-11-16(28)14-10-17(29)18(30)12-24(14,3)22(15)19(31)13-25(20,27)4/h11,14,17-22,29-33H,6-10,12-13H2,1-5H3/t14-,17+,18-,19+,20-,21+,22+,24-,25+,26+,27+/m0/s1 |
| |
ESI-MS m/z (relative intensity %) | 517 (15) [M+K]+, 501 (25) [M+Na]+, 479 (15) [M+H]+, 461 (5) [M+H-H2O]+, 443 (20) [M+H-2H2O]+, 425 (20) [M+H-3H2O]+, 407 (100) [M+H-4H2O]+ | CI-MS (NH3) m/z | | HR-ESI-MS | 478.2925, calculated 478.2919 for C27H42O7+ |
|
|
CD3OD | 01 | 39.3 | 02 | 69.1 | 03 | 68.7 | 04 | 33.5 | 05 | 52.9 | 06 | | 07 | 122.9 | 08 | 165.9 | 09 | 43.1 | 10 | | 11 | 69.7 | 12 | 43.8 | 13 | 48.5 | 14 | 85.0 | 15 | 32.0 | 16 | 21.9 | 17 | 51.8 | 18 | 19.1 | 19 | 24.8 | 20 | 77.4 | 21 | 20.9 | 22 | 85.7 | 23 | 28.63 | 24 | 39.8 | 25 | 82.0 | 26 | 28.54 | 27 | 29.1 |
|
CD3OD | 01-Ha | 1.34-1.40 | 01-He | 2.58 (ddd, 12.8, 4.5, 0.7) | 02-Ha | 4.01 (ddd, 12.1, 4.2, 3.3) | 03-He | 3.95 (q, 2.7) | 04-Ha | 1.75-1.81 (m) | 04-He | 1.69 (dt, 14.2, 3.6) | 05-H | 2.33 (dd, 13.1, 3.7) | 07-H | 5.80 (dd, 2.7, 0.7) | 09-H | 3.145 (dd, 8.8, 2.7) | 11-Ha | 4.05-4.13 (m) | 12-Ha | 2.23 (dd, 12.5, 10.4) | 12-He | 2.13 (dd, 12.4, 6.0) | 15-Ha | 1.56-1.62 (m) | 15-Hb | 1.97-2.00 (m) | 16-Ha | 1.80-1.83 (m) | 16-Hb | 1.96-1.98 (m) | 17-H | 2.40 (dd, 9.6, 8.6) | 18-Me | 0.83 (s) | 19-Me | 1.05 (s) | 21-Me | 1.235 (s) | 22-H | 3.92 (dd, 8.2, 6.1) | 23-Ha | 1.74-1.78 (m) | 23-Hb | 1.89-1.93 (m) | 24-Ha | 1.71-1.78 (m) | 24-Hb | 1.71-1.78 (m) | 26-Me | 1.248 (s) | 27-Me | 1.252 (s) |
|
| |
M.P. | °C ; | [α]D25.5 | +7 ° (c 0.1; MeOH) | IR (KBr) ν max (cm-1) | | UV (EtOH) λ max (log ε) | 249 (3.543) |
| |
| |
| |
|
Permanent link to this datasheet: 11α-HYDROXYSHIDASTERONE
|
|