|
|
Year of first isolation: |
1968 |
Formula: | C29H48O7 |
Molecular weight: | 508 |
Occurence in plants: |
Cyathula capitata [Amaranthaceae] » ![Wikipedia: <br />
<b>Warning</b>: preg_replace() [<a href='function.preg-replace'>function.preg-replace</a>]: No ending delimiter '&' found in <b>/usr/local/www/apache22/data/ecdybase.org/www/sheet.inc</b> on line <b>63</b><br />](/images/wikipedia.png)
|
Occurence in animals: |
|
|
| |
Canonical SMILES | CC(C)C(CCO)CC(C(C)(C1CCC2(C1(CCC3C2=CC(=O)C4C3(CC(C(C4)O)O)C)C)O)O)O | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2([C@@H](C[C@H]([C@H]1O)O)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2[C@](C)([C@@H](C[C@H](C(C)C)CCO)O)O)O)C)C » 
| IUPAC Name | (2S,3R,5R,9R,10R,13R,14S,17S)-17-[(2R,3R,5R)-2,3-dihydroxy-5-(2-hydroxyethyl)-6-methylheptan-2-yl]-2,3,14-trihydroxy-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one | CAS-RN | 21132-15-0 | PubChem CID | 101297612 | InChiKey [ ChemIDPlus: search ] | ZAZAHHNLVSCQOT-BQBPTSSQSA-N | InChI | InChI=1S/C29H48O7/c1-16(2)17(8-11-30)12-25(34)28(5,35)24-7-10-29(36)19-13-21(31)20-14-22(32)23(33)15-26(20,3)18(19)6-9-27(24,29)4/h13,16-18,20,22-25,30,32-36H,6-12,14-15H2,1-5H3/t17-,18+,20+,22-,23+,24+,25-,26-,27-,28-,29-/m1/s1 |
| |
CI-MS (NH3) m/z | | EI-MS m/z (relative intensity %) | 508 (M)+, 363 (M - C22-C29)+, 345, 327. | HR-MS | |
|
|
C5D5N | 01 | | 02 | | 03 | | 04 | | 05 | | 06 | | 07 | | 08 | | 09 | | 10 | | 11 | | 12 | | 13 | | 14 | | 15 | | 16 | | 17 | | 18 | | 19 | | 20 | | 21 | | 22 | | 23 | | 24 | | 25 | | 26 | | 27 | | 28 | | 29 | |
|
C5D5N | 01-Ha | | 01-Hb | | 02-Ha | | 03-He | | 04-Ha | | 04-He | | 05-H | | 07-H | 6.22 | 09-Ha | | 11-Ha | | 11-He | | 12-Ha | | 12-He | | 15-Ha | | 15-Hb | | 16-Ha | | 16-Hb | | 17-H | | 18-Me | 1.22 (s ) | 19-Me | 1.07 (s ) | 21-Me | 1.56 (s ) | 22-H | | 23-Ha | | 23-Hb | | 24-Ha | | 25-H | | 26-Me | 0.91 (d ) | 27-Me | 0.91 (d ) | 29-CH2O- | -- |
CDCl3 (tetra-OAc) | 01-Ha | | 01-Hb | | 02-Ha | 5.06 (ddd ) | 03-He | 5.32 (ddd ) | 04-Ha | | 04-He | | 05-H | | 07-H | 5.86 (d ) | 09-Ha | 3.10 (ddd ) | 11-Ha | | 11-He | | 12-Ha | | 12-He | | 15-Ha | | 15-Hb | | 16-Ha | | 16-Hb | | 17-H | | 18-Me | 0.86 (s ) | 19-Me | 1.03 (s ) | 21-Me | 1.24 (s ) | 22-H | 4.94 (dd ) | 23-Ha | | 23-Hb | | 24-Ha | | 25-H | | 26-Me | 0.84 (d ) | 27-Me | 0.86 (d ) | 29-CH2O- | 3.92 (dd , 2H) |
|
| |
M.P. | 284-285 °C | [α]D20 | + 82 ° in dioxan (5?-hydrogen) | IR (KBr) ν max (cm-1) | -- (OH), 1650 (cyclohexenone) | UV (EtOH) λ max (log ε) | 244 (?) ; |
| |
| |
Sarcophaga assay: highly active |
| |
|
Permanent link to this datasheet: AMARASTERONE B
|
|