|
|
Year of first isolation: |
1992 |
Formula: | C19H26O5 |
Molecular weight: | 334 |
Occurence in plants: |
Serratula tinctoria [Asteraceae] » ![Wikipedia: <br />
<b>Warning</b>: preg_replace() [<a href='function.preg-replace'>function.preg-replace</a>]: No ending delimiter '&' found in <b>/usr/local/www/apache22/data/ecdybase.org/www/sheet.inc</b> on line <b>63</b><br />](/images/wikipedia.png)
|
Occurence in animals: |
|
|
| |
Canonical SMILES | CC12CCC3C(=CC(=O)C4C3(CC(C(C4)O)O)C)C1(CCC2=O)O | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2([C@@H](C[C@@H]([C@H]1O)O)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CCC2=O)O)C)C » 
| IUPAC Name | (2S,3S,5R,9R,10R,13S,14R)-2,3,14-trihydroxy-10,13-dimethyl-1,2,3,4,5,9,11,12,15,16-decahydrocyclopenta[a]phenanthrene-6,17-dione | CAS-RN | | PubChem CID | 101642415 | InChiKey [ ChemIDPlus: search ] | OMQCWEJQYPUGJG-XZDQPVSKSA-N | InChI | InChI=1S/C19H26O5/c1-17-9-15(22)14(21)8-12(17)13(20)7-11-10(17)3-5-18(2)16(23)4-6-19(11,18)24/h7,10,12,14-15,21-22,24H,3-6,8-9H2,1-2H3/t10-,12-,14-,15-,17+,18+,19+/m0/s1 |
| |
CI-MS (NH3) m/z | 352 (M+H+NH3)+, 335 (M+H)+, 317, 299, 237, 221 | EI-MS m/z (relative intensity %) | | HR-MS | |
|
|
C5D5N | 01 | | 02 | | 03 | | 04 | | 05 | | 06 | | 07 | | 08 | | 09 | | 10 | | 11 | | 12 | | 13 | | 14 | | 15 | | 16 | | 17 | | 18 | | 19 | |
|
CD3OD | 01-Ha | 1.12 (dd, 12,13) | 01-Hb | | 02-Ha | 3.70 (ddd, 4,9,12) | 03-Ha | 3.42 (ddd, 5,9,12) | 04-Ha | | 04-He | | 05-H | 2.14 | 07-H | 5.92 (d, 2.5) | 09-Ha | 3.18 (ddd, 2.5,7,11) | 11-Ha | | 11-He | | 12-Ha | | 12-He | | 15-Ha | | 15-Hb | | 16-Ha | | 16-Hb | | 18-Me | 0.88 (s ) | 19-Me | 0.98 (s ) |
|
| |
M.P. | | [α]D20 | | IR (KBr) ν max (cm-1) | | UV (EtOH) λ max (log ε) | |
| |
HPTLC | | TLC | | GLC | | NP-HPLC | Ret 13.1 min (Column Zorbax-Sil, 25 cm x 4.6 mm i.d., solvent iso-C8-iPrOH-H2O, 100:30:2 v/v/v, flow-rate 1ml.min-1) (20E 22.6 min, rubrosterone 14.4 min) | RP-HPLC | Ret 5.7 min (Column Spherisorb-5ODS2, 25 cm x 4.6 mm i.d., solvent ACN : 1? TFA in H2O 23:77 v/v, flow-rate 1ml.min-1) (20E 5.2 min, rubrosterone 5.3 min) |
| |
| |
|
Permanent link to this datasheet: 3-EPI-RUBROSTERONE
|
|