|
|
Year of first isolation: |
1997 |
Formula: | C32H52O11 |
Molecular weight: | 612 |
Occurence in plants: |
Limnanthes douglasii [Limnanthaceae] » ![Wikipedia: <br />
<b>Warning</b>: preg_replace() [<a href='function.preg-replace'>function.preg-replace</a>]: No ending delimiter '&' found in <b>/usr/local/www/apache22/data/ecdybase.org/www/sheet.inc</b> on line <b>63</b><br />](/images/wikipedia.png)
|
Occurence in animals: |
|
|
| |
Canonical SMILES | CC12CCC3C(=CC(=O)C4C3(CC(C(C4)OC5C(C(C(CO5)O)O)O)O)C)C1(CCC2C(C)(C(CCC(C)(C)O)O)O)O | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2([C@@H](C[C@H]([C@H]1O)O[C@H]1C(C([C@@H](CO1)O)O)O)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2[C@](C)([C@H](O)CCC(C)(C)O)O)O)C)C » 
| IUPAC Name | (2S,3R,5R,10R,13R,14S)-2,14-dihydroxy-10,13-dimethyl-17-[(2R,3R)-2,3,6-trihydroxy-6-methylheptan-2-yl]-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one | CAS-RN | | PubChem CID | 24984732 | InChiKey [ ChemIDPlus: search ] | TWFDWCNWDDFMIA-AYUKSNEASA-N | InChI | InChI=1S/C32H52O11/c1-28(2,39)9-8-24(36)31(5,40)23-7-11-32(41)17-12-19(33)18-13-22(43-27-26(38)25(37)21(35)15-42-27)20(34)14-29(18,3)16(17)6-10-30(23,32)4/h12,16,18,20-27,34-41H,6-11,13-15H2,1-5H3/t16?,18-,20-,21+,22+,23?,24+,25-,26+,27-,29+,30+,31+,32+/m0/s1 |
| |
CI-MS (NH3) m/z | 630 (M+H+NH3)+, 613 (M+H)+, 595, 559, 541, 496, 481, 463, 461, 445, 427, 363, 345, 301 | EI-MS m/z (relative intensity %) | | HR-MS | |
|
|
D2O | 01 | 37.4 | 02 | 68.8 | 03 | 76.0 | 04 | 29.8 | 05 | 51.3 | 06 | | 07 | 122.0 | 08 | | 09 | 35.8 | 10 | 38.9 | 11 | 21.0 | 12 | 31.8 | 13 | 48.3 | 14 | 86.3 | 15 | 32.5 | 16 | 21.1 | 17 | 50.1 | 18 | 18.0 | 19 | 24.0 | 20 | 78.1 | 21 | 20.6 | 22 | 79.0 | 23 | 27.0 | 24 | 41.8 | 25 | 72.1 | 26 | 28.5 | 27 | 29.2 | C-1' | 101.8 | C-2' | 74.3 | C-3' | 77.0 | C-4' | 71.0 | C-5' | 66.4 |
|
D2O | 01-Ha | 1.46 (t, 13.0) | 01-Hb | 1.98 | 02-Ha | 4.03 (dt, w1/2 = 22) | 03-He | 4.15 (m, w1/2 = 8) | 04-Ha | 1.75 | 04-He | 1.90 | 05-H | 2.43 (dd, 13.5, 3.5) | 07-H | 5.98 (d, 2.5) | 09-Ha | 3.12 (m, w1/2 = 22) | 11-Ha | 1.75 | 11-He | 1.86 | 12-Ha | 1.95 | 12-He | 1.75 | 15-Ha | 2.05* | 15-Hb | 1.65* | 16-Ha | 1.85** | 16-Hb | 1.80** | 17-H | 2.33 (t, 9.6) | 18-Me | 0.87 (s ) | 19-Me | 1.00 (s ) | 21-Me | 1.25 (s ) | 22-H | 3.43 (dd, 10.7, 1.4) | 23-Ha | 1.33 | 23-Hb | 1.65 | 24-Ha | 1.52 (dt, 12.8, 3.4) | 24-Hb | 1.80 | 26-Me | 1.23 (s ) | 27-Me | 1.24 (s ) | s1-H' | 4.48 (d, 7.8) | s2-H' | 3.33 (dd, 7.8, 9.3) | s3-H' | 3.47 (t, 9.3) | s4-H' | 3.65 (ddd, 5.5, 9.2, 10.5) | s5-H" | 3.29 (dd, 10.5, 11.6) | s5-H' | 3.96 (dd, 5.5, 11.6) |
|
| |
M.P. | | [α]D20 | | IR (KBr) ν max (cm-1) | | UV (EtOH) λ max (log ε) | 241 (3.96) |
| |
HPTLC | | TLC | | NP-HPLC | column Zorbax-Sil (250x4.6 mm), solvent cyclohexane-iPrOH-H2O (80:40:3), flow-rate 1 ml.min-1, Ret 23.2 min (20E 12.3 min); solvent CH2Cl2-iPrOH-H2O (125:50:5), flow-rate 1 ml.min-1, Ret 21.3 min (20E 10.1 min) | RP-HPLC | column Spherisob 5ODS2 (250x4.6 mm), solvent 18% ACN-iPrOH (5:2) in 0.1% TFA in H2O, flow-rate 1 ml.min-1, Ret 13.3 min (20E : 13.9 min). |
| |
Drosophila melanogaster BII cell assay: EC50 = 1.6 x 10-6M |
| |
|
Permanent link to this datasheet: LIMNANTHEOSIDE A
|
|