|
|
Year of first isolation: |
1996 |
Formula: | C34H48O6 |
Molecular weight: | 552 |
Occurence in plants: |
Silene tomentella [Caryophyllaceae] » ![Wikipedia: <br />
<b>Warning</b>: preg_replace() [<a href='function.preg-replace'>function.preg-replace</a>]: No ending delimiter '&' found in <b>/usr/local/www/apache22/data/ecdybase.org/www/sheet.inc</b> on line <b>63</b><br />](/images/wikipedia.png)
|
Occurence in animals: |
|
|
| |
Canonical SMILES | CC(C1CCC2(C1(CCC3C2=CC(=O)C4C3(CCC(C4)O)C)C)O)C(CCC(C)(C)OC(=O)C5=CC=CC=C5)O | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2([C@H](C[C@H](C1)O)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2[C@H](C)[C@H](O)CCC(C)(C)OC(=O)c1ccccc1)O)C)C » 
| IUPAC Name | [(5R,6S)-6-[(3S,5S,9R,10R,13R,14S,17R)-3,14-dihydroxy-10,13-dimethyl-6-oxo-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-5-hydroxy-2-methylheptan-2-yl] benzoate | CAS-RN | | PubChem CID | 15385310 | InChiKey [ ChemIDPlus: search ] | UPRPZAIRAGNHAE-FIKQRJOMSA-N | InChI | InChI=1S/C34H48O6/c1-21(28(36)14-15-31(2,3)40-30(38)22-9-7-6-8-10-22)24-13-18-34(39)26-20-29(37)27-19-23(35)11-16-32(27,4)25(26)12-17-33(24,34)5/h6-10,20-21,23-25,27-28,35-36,39H,11-19H2,1-5H3/t21-,23-,24+,25-,27+,28+,32+,33+,34+/m0/s1 |
| |
CI-MS (NH3) m/z | | EI-MS m/z (relative intensity %) | 430 (M-122)+ (24), 415 (24), 412 (44), 397 (24), 379 (24), 332 (44), 284 (84), 234 (82), 122 (100), 105 (66), 99 (32), 77 (42). | HR-MS | |
|
|
C5D5N | 01 | | 02 | | 03 | | 04 | | 05 | | 06 | | 07 | | 08 | | 09 | | 10 | | 11 | | 12 | | 13 | | 14 | | 15 | | 16 | | 17 | | 18 | | 19 | | 20 | | 21 | | 22 | | 23 | | 24 | | 25 | | 26 | | 27 | |
|
C5D5N | 01-Ha | | 01-He | | 02-Ha | | 02-He | | 03-Ha | 4.09 | 04-Ha | | 04-He | | 05-H | | 07-H | 6.16 (d ) | 11-Ha | | 11-He | | 12-Ha | | 12-He | | 15-Ha | | 15-Hb | | 16-Ha | | 16-Hb | | 17-H | | 18-Me | 0.71 | 19-Me | 0.89 | 20-H | | 21-Me | 1.30 (d ) | 22-H | 4.09 | 23-Ha | | 23-Hb | | 24-Ha | | 24-Hb | | 26-Me | 1.65 | 27-Me | 1.65 | H-aromat. | 7.49 (3H); 8.22 (2H) |
|
| |
M.P. | 145-147 °C | [α]D20 | | IR (KBr) ν max (cm-1) | 3429 (OH), 1662 (cyclohexenone), 1712, 1292, 1584, 713 | UV (EtOH) λ max (log ε) | |
| |
| |
| |
|
Permanent link to this datasheet: TOMENTESTERONE B
|
|